@article{article, title = {{Nanostructure of CaO-(Na2O)-Al2O3-SiO2-H2O gels revealed by multinuclear solid-state magic angle spinning and multiple quantum magic angle spinning nuclear magnetic resonance spectroscopy}}, publisher = {{American Chemical Society (ACS)}}, url = {{http://eprints.whiterose.ac.uk/157832/ }}, year = {{2020}}, month = {{1}}, author = {{Walkley B and Page SJ and Rees GJ and Provis JL and Hanna JV}}, doi = {{10.1021/acs.jpcc.9b10133}}, volume = {{124}}, journal = {{The Journal of Physical Chemistry C}}, issue = {{2}}, pages = {{1681-1694}}, note = {{Accessed on 2025/05/23}}}